C23H31NO4 — CID 46649897
N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 46649897) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46649897 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | CCOc1ccc(C(NC(=O)Cc2ccc(OC)cc2)C(C)C)cc1OCC |
| InChI | InChI=1S/C23H31NO4/c1-6-27-20-13-10-18(15-21(20)28-7-2)23(16(3)4)24-22(25)14-17-8-11-19(26-5)12-9-17/h8-13,15-16,23H,6-7,14H2,1-5H3,(H,24,25) |
| InChIKey | NCVRFRCEDQRAOL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |