About N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide
N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide (PubChem CID 75896022) has the molecular formula C20H31NO3
and a molecular weight of 333.47 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide.
Molecular Properties
| Compound Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide |
| PubChem CID | 75896022 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide |
| SMILES | CCC=C(C)C(=O)NC(c1ccc(OCC)c(OCC)c1)C(C)C |
| InChI | InChI=1S/C20H31NO3/c1-7-10-15(6)20(22)21-19(14(4)5)16-11-12-17(23-8-2)18(13-16)24-9-3/h10-14,19H,7-9H2,1-6H3,(H,21,22) |
| InChIKey | SIHWLRUOERWNJO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide?
The IUPAC name of N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide (CID 75896022) is N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide.
What is the SMILES notation for N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide?
The canonical SMILES for N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide is CCC=C(C)C(=O)NC(c1ccc(OCC)c(OCC)c1)C(C)C.
What is the InChIKey of N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide?
The InChIKey is SIHWLRUOERWNJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31NO3/c1-7-10-15(6)20(22)21-19(14(4)5)16-11-12-17(23-8-2)18(13-16)24-9-3/h10-14,19H,7-9H2,1-6H3,(H,21,22).
What are the key properties of N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide?
N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide has a molecular weight of 333.47 g/mol, XLogP of 4.65, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-methylpent-2-enamide is sourced from PubChem (CID 75896022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).