C15H25NO4S — CID 51263519
N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]methanesulfonamide (PubChem CID 51263519) has the molecular formula C15H25NO4S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]methanesulfonamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]methanesulfonamide |
|---|---|
| PubChem CID | 51263519 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]methanesulfonamide |
| SMILES | CCOc1ccc(C(NS(C)(=O)=O)C(C)C)cc1OCC |
| InChI | InChI=1S/C15H25NO4S/c1-6-19-13-9-8-12(10-14(13)20-7-2)15(11(3)4)16-21(5,17)18/h8-11,15-16H,6-7H2,1-5H3 |
| InChIKey | ZQXNBELJTLSTJI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |