C22H29NO5S — CID 55447557
N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-3-methylsulfonylbenzamide (PubChem CID 55447557) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 55447557 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-3-methylsulfonylbenzamide |
| SMILES | CCOc1ccc(C(NC(=O)c2cccc(S(C)(=O)=O)c2)C(C)C)cc1OCC |
| InChI | InChI=1S/C22H29NO5S/c1-6-27-19-12-11-16(14-20(19)28-7-2)21(15(3)4)23-22(24)17-9-8-10-18(13-17)29(5,25)26/h8-15,21H,6-7H2,1-5H3,(H,23,24) |
| InChIKey | RLZZQIYYXNPUNO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |