C20H26N2O4 — CID 60551019
N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 60551019) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 60551019 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | CCOc1ccc(C(NC(=O)c2cccc[n+]2[O-])C(C)C)cc1OCC |
| InChI | InChI=1S/C20H26N2O4/c1-5-25-17-11-10-15(13-18(17)26-6-2)19(14(3)4)21-20(23)16-9-7-8-12-22(16)24/h7-14,19H,5-6H2,1-4H3,(H,21,23) |
| InChIKey | SXEUQTBIAVCRDZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|