C18H22N2O3S — CID 96550294
N-[(1S)-2-methyl-1-(3-methyl-2-pyridinyl)propyl]-3-methylsulfonylbenzamide (PubChem CID 96550294) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-[(1S)-2-methyl-1-(3-methyl-2-pyridinyl)propyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[(1S)-2-methyl-1-(3-methyl-2-pyridinyl)propyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 96550294 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[(1S)-2-methyl-1-(3-methyl-2-pyridinyl)propyl]-3-methylsulfonylbenzamide |
| SMILES | Cc1cccnc1[C@@H](NC(=O)c1cccc(S(C)(=O)=O)c1)C(C)C |
| InChI | InChI=1S/C18H22N2O3S/c1-12(2)16(17-13(3)7-6-10-19-17)20-18(21)14-8-5-9-15(11-14)24(4,22)23/h5-12,16H,1-4H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | SZBPRBINTVCXSB-INIZCTEOSA-N |
| XLogP | 2.92 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |