C14H20BrNO3S — CID 114311708
N-(1-bromo-4-methylpentan-2-yl)-3-methylsulfonylbenzamide (PubChem CID 114311708) has the molecular formula C14H20BrNO3S and a molecular weight of 362.29 g/mol. Its IUPAC name is N-(1-bromo-4-methylpentan-2-yl)-3-methylsulfonylbenzamide.
| Compound Name | N-(1-bromo-4-methylpentan-2-yl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 114311708 |
| Molecular Formula | C14H20BrNO3S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-(1-bromo-4-methylpentan-2-yl)-3-methylsulfonylbenzamide |
| SMILES | CC(C)CC(CBr)NC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H20BrNO3S/c1-10(2)7-12(9-15)16-14(17)11-5-4-6-13(8-11)20(3,18)19/h4-6,8,10,12H,7,9H2,1-3H3,(H,16,17) |
| InChIKey | BLCUDFLNASTEOV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|