C13H16Br3NO — CID 107975115
3,5-dibromo-N-(1-bromo-4-methylpentan-2-yl)benzamide (PubChem CID 107975115) has the molecular formula C13H16Br3NO and a molecular weight of 441.99 g/mol. Its IUPAC name is 3,5-dibromo-N-(1-bromo-4-methylpentan-2-yl)benzamide.
| Compound Name | 3,5-dibromo-N-(1-bromo-4-methylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 107975115 |
| Molecular Formula | C13H16Br3NO |
| Molecular Weight | 441.99 g/mol |
| Exact Mass | 438.88 |
| IUPAC Name | 3,5-dibromo-N-(1-bromo-4-methylpentan-2-yl)benzamide |
| SMILES | CC(C)CC(CBr)NC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H16Br3NO/c1-8(2)3-12(7-14)17-13(18)9-4-10(15)6-11(16)5-9/h4-6,8,12H,3,7H2,1-2H3,(H,17,18) |
| InChIKey | FLNRUFSDWGMRHA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.99 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|