C11H14BrNO3S — CID 114308747
N-(2-bromopropyl)-3-methylsulfonylbenzamide (PubChem CID 114308747) has the molecular formula C11H14BrNO3S and a molecular weight of 320.21 g/mol. Its IUPAC name is N-(2-bromopropyl)-3-methylsulfonylbenzamide.
| Compound Name | N-(2-bromopropyl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 114308747 |
| Molecular Formula | C11H14BrNO3S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | N-(2-bromopropyl)-3-methylsulfonylbenzamide |
| SMILES | CC(Br)CNC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H14BrNO3S/c1-8(12)7-13-11(14)9-4-3-5-10(6-9)17(2,15)16/h3-6,8H,7H2,1-2H3,(H,13,14) |
| InChIKey | XECAUWJGWJUYPK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|