C12H14INO5S — CID 103493340
methyl 2-iodo-3-[(3-methylsulfonylbenzoyl)amino]propanoate (PubChem CID 103493340) has the molecular formula C12H14INO5S and a molecular weight of 411.22 g/mol. Its IUPAC name is methyl 2-iodo-3-[(3-methylsulfonylbenzoyl)amino]propanoate.
| Compound Name | methyl 2-iodo-3-[(3-methylsulfonylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 103493340 |
| Molecular Formula | C12H14INO5S |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | methyl 2-iodo-3-[(3-methylsulfonylbenzoyl)amino]propanoate |
| SMILES | COC(=O)C(I)CNC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H14INO5S/c1-19-12(16)10(13)7-14-11(15)8-4-3-5-9(6-8)20(2,17)18/h3-6,10H,7H2,1-2H3,(H,14,15) |
| InChIKey | HFMLJCOXRWREKC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|