C23H32N2O3 — CID 120608398
3-(2-aminophenyl)-N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]propanamide (PubChem CID 120608398) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]propanamide.
| Compound Name | 3-(2-aminophenyl)-N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]propanamide |
|---|---|
| PubChem CID | 120608398 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 3-(2-aminophenyl)-N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]propanamide |
| SMILES | CCOc1ccc(C(NC(=O)CCc2ccccc2N)C(C)C)cc1OCC |
| InChI | InChI=1S/C23H32N2O3/c1-5-27-20-13-11-18(15-21(20)28-6-2)23(16(3)4)25-22(26)14-12-17-9-7-8-10-19(17)24/h7-11,13,15-16,23H,5-6,12,14,24H2,1-4H3,(H,25,26) |
| InChIKey | DRRIZRAMUFEIKR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|