C28H32FNO3 — CID 57131511
ethyl 3-[benzyl(1-phenylethyl)amino]-3-(4-ethoxy-3-fluorophenyl)propanoate (PubChem CID 57131511) has the molecular formula C28H32FNO3 and a molecular weight of 449.57 g/mol. Its IUPAC name is ethyl 3-[benzyl(1-phenylethyl)amino]-3-(4-ethoxy-3-fluorophenyl)propanoate.
| Compound Name | ethyl 3-[benzyl(1-phenylethyl)amino]-3-(4-ethoxy-3-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 57131511 |
| Molecular Formula | C28H32FNO3 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | ethyl 3-[benzyl(1-phenylethyl)amino]-3-(4-ethoxy-3-fluorophenyl)propanoate |
| SMILES | CCOC(=O)CC(c1ccc(OCC)c(F)c1)N(Cc1ccccc1)C(C)c1ccccc1 |
| InChI | InChI=1S/C28H32FNO3/c1-4-32-27-17-16-24(18-25(27)29)26(19-28(31)33-5-2)30(20-22-12-8-6-9-13-22)21(3)23-14-10-7-11-15-23/h6-18,21,26H,4-5,19-20H2,1-3H3 |
| InChIKey | OWRTZJHTQKFVDJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |