C24H33NO2 — CID 70133570
ethyl (3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-5-methylhexanoate (PubChem CID 70133570) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is ethyl (3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-5-methylhexanoate.
| Compound Name | ethyl (3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-5-methylhexanoate |
|---|---|
| PubChem CID | 70133570 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | ethyl (3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-5-methylhexanoate |
| SMILES | CCOC(=O)C[C@@H](CC(C)C)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C24H33NO2/c1-5-27-24(26)17-23(16-19(2)3)25(18-21-12-8-6-9-13-21)20(4)22-14-10-7-11-15-22/h6-15,19-20,23H,5,16-18H2,1-4H3/t20-,23-/m1/s1 |
| InChIKey | OAJGPQKVPSUVSV-NFBKMPQASA-N |
| XLogP | 5.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |