C18H27NO4 — CID 158794759
3-[benzyl-(4-ethoxy-4-oxobutan-2-yl)amino]pentanoic acid (PubChem CID 158794759) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-[benzyl-(4-ethoxy-4-oxobutan-2-yl)amino]pentanoic acid.
| Compound Name | 3-[benzyl-(4-ethoxy-4-oxobutan-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 158794759 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 3-[benzyl-(4-ethoxy-4-oxobutan-2-yl)amino]pentanoic acid |
| SMILES | CCOC(=O)CC(C)N(Cc1ccccc1)C(CC)CC(=O)O |
| InChI | InChI=1S/C18H27NO4/c1-4-16(12-17(20)21)19(13-15-9-7-6-8-10-15)14(3)11-18(22)23-5-2/h6-10,14,16H,4-5,11-13H2,1-3H3,(H,20,21) |
| InChIKey | ISSONJKXMXVRBE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |