C41H50N2O4 — CID 11365677
dimethyl (3R,7R)-3,7-bis[benzyl-[(1R)-1-phenylethyl]amino]nonanedioate (PubChem CID 11365677) has the molecular formula C41H50N2O4 and a molecular weight of 634.86 g/mol. Its IUPAC name is dimethyl (3R,7R)-3,7-bis[benzyl-[(1R)-1-phenylethyl]amino]nonanedioate.
| Compound Name | dimethyl (3R,7R)-3,7-bis[benzyl-[(1R)-1-phenylethyl]amino]nonanedioate |
|---|---|
| PubChem CID | 11365677 |
| Molecular Formula | C41H50N2O4 |
| Molecular Weight | 634.86 g/mol |
| Exact Mass | 634.38 |
| IUPAC Name | dimethyl (3R,7R)-3,7-bis[benzyl-[(1R)-1-phenylethyl]amino]nonanedioate |
| SMILES | COC(=O)C[C@@H](CCC[C@H](CC(=O)OC)N(Cc1ccccc1)[C@H](C)c1ccccc1)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C41H50N2O4/c1-32(36-22-13-7-14-23-36)42(30-34-18-9-5-10-19-34)38(28-40(44)46-3)26-17-27-39(29-41(45)47-4)43(31-35-20-11-6-12-21-35)33(2)37-24-15-8-16-25-37/h5-16,18-25,32-33,38-39H,17,26-31H2,1-4H3/t32-,33-,38-,39-/m1/s1 |
| InChIKey | YWSWIOIEMWMQSQ-ALTGNGJPSA-N |
| XLogP | 8.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.86 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |