C24H33NO2 — CID 68953635
(3S,5R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-5-methyloctanoic acid (PubChem CID 68953635) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is (3S,5R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-5-methyloctanoic acid.
| Compound Name | (3S,5R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-5-methyloctanoic acid |
|---|---|
| PubChem CID | 68953635 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (3S,5R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-5-methyloctanoic acid |
| SMILES | CCC[C@@H](C)C[C@@H](CC(=O)O)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C24H33NO2/c1-4-11-19(2)16-23(17-24(26)27)25(18-21-12-7-5-8-13-21)20(3)22-14-9-6-10-15-22/h5-10,12-15,19-20,23H,4,11,16-18H2,1-3H3,(H,26,27)/t19-,20+,23+/m1/s1 |
| InChIKey | SUXHKLBYHLPTFD-QTEQDKRBSA-N |
| XLogP | 5.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |