C26H36N2O — CID 126634358
(3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-N-cyclopropyl-4-methylheptanamide (PubChem CID 126634358) has the molecular formula C26H36N2O and a molecular weight of 392.59 g/mol. Its IUPAC name is (3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-N-cyclopropyl-4-methylheptanamide.
| Compound Name | (3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-N-cyclopropyl-4-methylheptanamide |
|---|---|
| PubChem CID | 126634358 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | (3R,4R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-N-cyclopropyl-4-methylheptanamide |
| SMILES | CCC[C@@H](C)[C@@H](CC(=O)NC1CC1)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H36N2O/c1-4-11-20(2)25(18-26(29)27-24-16-17-24)28(19-22-12-7-5-8-13-22)21(3)23-14-9-6-10-15-23/h5-10,12-15,20-21,24-25H,4,11,16-19H2,1-3H3,(H,27,29)/t20-,21+,25-/m1/s1 |
| InChIKey | CCBMKYNOXMAVKL-TYBLODHISA-N |
| XLogP | 5.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |