C33H47NO4 — CID 100977450
dipentan-3-yl (E,6R)-6-[benzyl-[(1R)-1-phenylethyl]amino]oct-2-enedioate (PubChem CID 100977450) has the molecular formula C33H47NO4 and a molecular weight of 521.74 g/mol. Its IUPAC name is dipentan-3-yl (E,6R)-6-[benzyl-[(1R)-1-phenylethyl]amino]oct-2-enedioate.
| Compound Name | dipentan-3-yl (E,6R)-6-[benzyl-[(1R)-1-phenylethyl]amino]oct-2-enedioate |
|---|---|
| PubChem CID | 100977450 |
| Molecular Formula | C33H47NO4 |
| Molecular Weight | 521.74 g/mol |
| Exact Mass | 521.35 |
| IUPAC Name | dipentan-3-yl (E,6R)-6-[benzyl-[(1R)-1-phenylethyl]amino]oct-2-enedioate |
| SMILES | CCC(CC)OC(=O)/C=C/CC[C@H](CC(=O)OC(CC)CC)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C33H47NO4/c1-6-30(7-2)37-32(35)23-17-16-22-29(24-33(36)38-31(8-3)9-4)34(25-27-18-12-10-13-19-27)26(5)28-20-14-11-15-21-28/h10-15,17-21,23,26,29-31H,6-9,16,22,24-25H2,1-5H3/b23-17+/t26-,29-/m1/s1 |
| InChIKey | DWCBQIYTYSKEHX-LXVDOVMFSA-N |
| XLogP | 7.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.74 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|