C21H25NO3 — CID 72949507
(E,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxyhex-4-enoic acid (PubChem CID 72949507) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (E,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxyhex-4-enoic acid.
| Compound Name | (E,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxyhex-4-enoic acid |
|---|---|
| PubChem CID | 72949507 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (E,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxyhex-4-enoic acid |
| SMILES | C/C=C/[C@@H](C(O)C(=O)O)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-3-10-19(20(23)21(24)25)22(15-17-11-6-4-7-12-17)16(2)18-13-8-5-9-14-18/h3-14,16,19-20,23H,15H2,1-2H3,(H,24,25)/b10-3+/t16-,19-,20?/m0/s1 |
| InChIKey | CTKIAQZDBYCZDY-QRENFYGISA-N |
| XLogP | 3.64 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|