C26H38N2O4 — CID 54257950
3-amino-2-methylbutanoic acid;methyl 3-[benzyl(1-phenylethyl)amino]-2-methylbutanoate (PubChem CID 54257950) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is 3-amino-2-methylbutanoic acid;methyl 3-[benzyl(1-phenylethyl)amino]-2-methylbutanoate.
| Compound Name | 3-amino-2-methylbutanoic acid;methyl 3-[benzyl(1-phenylethyl)amino]-2-methylbutanoate |
|---|---|
| PubChem CID | 54257950 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 3-amino-2-methylbutanoic acid;methyl 3-[benzyl(1-phenylethyl)amino]-2-methylbutanoate |
| SMILES | CC(N)C(C)C(=O)O.COC(=O)C(C)C(C)N(Cc1ccccc1)C(C)c1ccccc1 |
| InChI | InChI=1S/C21H27NO2.C5H11NO2/c1-16(21(23)24-4)17(2)22(15-19-11-7-5-8-12-19)18(3)20-13-9-6-10-14-20;1-3(4(2)6)5(7)8/h5-14,16-18H,15H2,1-4H3;3-4H,6H2,1-2H3,(H,7,8) |
| InChIKey | RBJWOWPGHUTBBH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |