C26H29NO3 — CID 59896331
methyl (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 59896331) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is methyl (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 59896331 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | methyl (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | COC(=O)C[C@@H](c1ccc(OC)cc1)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H29NO3/c1-20(22-12-8-5-9-13-22)27(19-21-10-6-4-7-11-21)25(18-26(28)30-3)23-14-16-24(29-2)17-15-23/h4-17,20,25H,18-19H2,1-3H3/t20-,25+/m1/s1 |
| InChIKey | YARBDLRHNCHMKV-NLFFAJNJSA-N |
| XLogP | 5.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |