C31H31NO3 — CID 135367602
(3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-[4-(2-methylphenoxy)phenyl]propanoic acid (PubChem CID 135367602) has the molecular formula C31H31NO3 and a molecular weight of 465.59 g/mol. Its IUPAC name is (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-[4-(2-methylphenoxy)phenyl]propanoic acid.
| Compound Name | (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-[4-(2-methylphenoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 135367602 |
| Molecular Formula | C31H31NO3 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-[4-(2-methylphenoxy)phenyl]propanoic acid |
| SMILES | Cc1ccccc1Oc1ccc([C@H](CC(=O)O)N(Cc2ccccc2)[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H31NO3/c1-23-11-9-10-16-30(23)35-28-19-17-27(18-20-28)29(21-31(33)34)32(22-25-12-5-3-6-13-25)24(2)26-14-7-4-8-15-26/h3-20,24,29H,21-22H2,1-2H3,(H,33,34)/t24-,29+/m1/s1 |
| InChIKey | HLKJISOMGQHGBJ-GIGWZHCTSA-N |
| XLogP | 7.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |