C40H51NO3Si — CID 134836354
benzyl (3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-3-[4-tri(propan-2-yl)silyloxyphenyl]propanoate (PubChem CID 134836354) has the molecular formula C40H51NO3Si and a molecular weight of 621.94 g/mol. Its IUPAC name is benzyl (3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-3-[4-tri(propan-2-yl)silyloxyphenyl]propanoate.
| Compound Name | benzyl (3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-3-[4-tri(propan-2-yl)silyloxyphenyl]propanoate |
|---|---|
| PubChem CID | 134836354 |
| Molecular Formula | C40H51NO3Si |
| Molecular Weight | 621.94 g/mol |
| Exact Mass | 621.36 |
| IUPAC Name | benzyl (3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-3-[4-tri(propan-2-yl)silyloxyphenyl]propanoate |
| SMILES | CC(C)[Si](Oc1ccc([C@@H](CC(=O)OCc2ccccc2)N(Cc2ccccc2)[C@@H](C)c2ccccc2)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H51NO3Si/c1-30(2)45(31(3)4,32(5)6)44-38-25-23-37(24-26-38)39(27-40(42)43-29-35-19-13-9-14-20-35)41(28-34-17-11-8-12-18-34)33(7)36-21-15-10-16-22-36/h8-26,30-33,39H,27-29H2,1-7H3/t33-,39+/m0/s1 |
| InChIKey | BXLSMGXSJOQXFM-XPNCQOHCSA-N |
| XLogP | 10.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.94 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|