C28H34N2O3 — CID 10863232
tert-butyl 3-[benzyl-[(1R)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-2-ylpropanoate (PubChem CID 10863232) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is tert-butyl 3-[benzyl-[(1R)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-2-ylpropanoate.
| Compound Name | tert-butyl 3-[benzyl-[(1R)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-2-ylpropanoate |
|---|---|
| PubChem CID | 10863232 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | tert-butyl 3-[benzyl-[(1R)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-2-ylpropanoate |
| SMILES | COc1ccc([C@@H](C)N(Cc2ccccc2)C(CC(=O)OC(C)(C)C)c2ccccn2)cc1 |
| InChI | InChI=1S/C28H34N2O3/c1-21(23-14-16-24(32-5)17-15-23)30(20-22-11-7-6-8-12-22)26(25-13-9-10-18-29-25)19-27(31)33-28(2,3)4/h6-18,21,26H,19-20H2,1-5H3/t21-,26?/m1/s1 |
| InChIKey | IJOCPEKQKATRBX-OSMGYRLQSA-N |
| XLogP | 6.13 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |