C24H32ClNO2 — CID 71490563
tert-butyl (3S)-3-[3-chloropropyl-[(1R)-1-phenylethyl]amino]-3-phenylpropanoate (PubChem CID 71490563) has the molecular formula C24H32ClNO2 and a molecular weight of 401.98 g/mol. Its IUPAC name is tert-butyl (3S)-3-[3-chloropropyl-[(1R)-1-phenylethyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl (3S)-3-[3-chloropropyl-[(1R)-1-phenylethyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 71490563 |
| Molecular Formula | C24H32ClNO2 |
| Molecular Weight | 401.98 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | tert-butyl (3S)-3-[3-chloropropyl-[(1R)-1-phenylethyl]amino]-3-phenylpropanoate |
| SMILES | C[C@H](c1ccccc1)N(CCCCl)[C@@H](CC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H32ClNO2/c1-19(20-12-7-5-8-13-20)26(17-11-16-25)22(21-14-9-6-10-15-21)18-23(27)28-24(2,3)4/h5-10,12-15,19,22H,11,16-18H2,1-4H3/t19-,22+/m1/s1 |
| InChIKey | LGLLALKMAAMMEB-KNQAVFIVSA-N |
| XLogP | 6.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.98 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|