C21H31NO2 — CID 10980402
tert-butyl (E,3R)-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]hex-4-enoate (PubChem CID 10980402) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is tert-butyl (E,3R)-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]hex-4-enoate.
| Compound Name | tert-butyl (E,3R)-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]hex-4-enoate |
|---|---|
| PubChem CID | 10980402 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | tert-butyl (E,3R)-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]hex-4-enoate |
| SMILES | C=CCN([C@@H](/C=C/C)CC(=O)OC(C)(C)C)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C21H31NO2/c1-7-12-19(16-20(23)24-21(4,5)6)22(15-8-2)17(3)18-13-10-9-11-14-18/h7-14,17,19H,2,15-16H2,1,3-6H3/b12-7+/t17-,19-/m0/s1 |
| InChIKey | YLVLWYOEAAYRHV-JSIZGQDVSA-N |
| XLogP | 4.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|