C22H33NO3 — CID 10991994
tert-butyl (2S,3R)-2-[(1R)-1-hydroxyethyl]-3-[[(1R)-1-phenylethyl]-prop-2-enylamino]pent-4-enoate (PubChem CID 10991994) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-[(1R)-1-hydroxyethyl]-3-[[(1R)-1-phenylethyl]-prop-2-enylamino]pent-4-enoate.
| Compound Name | tert-butyl (2S,3R)-2-[(1R)-1-hydroxyethyl]-3-[[(1R)-1-phenylethyl]-prop-2-enylamino]pent-4-enoate |
|---|---|
| PubChem CID | 10991994 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | tert-butyl (2S,3R)-2-[(1R)-1-hydroxyethyl]-3-[[(1R)-1-phenylethyl]-prop-2-enylamino]pent-4-enoate |
| SMILES | C=CCN([C@H](C)c1ccccc1)[C@H](C=C)[C@H](C(=O)OC(C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C22H33NO3/c1-8-15-23(16(3)18-13-11-10-12-14-18)19(9-2)20(17(4)24)21(25)26-22(5,6)7/h8-14,16-17,19-20,24H,1-2,15H2,3-7H3/t16-,17-,19-,20-/m1/s1 |
| InChIKey | RJYUCRVXTKCDAU-HNBVOPMISA-N |
| XLogP | 4.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|