C24H31NO2 — CID 86755237
tert-butyl (3R)-3-phenyl-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]propanoate (PubChem CID 86755237) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is tert-butyl (3R)-3-phenyl-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]propanoate.
| Compound Name | tert-butyl (3R)-3-phenyl-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]propanoate |
|---|---|
| PubChem CID | 86755237 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | tert-butyl (3R)-3-phenyl-3-[[(1S)-1-phenylethyl]-prop-2-enylamino]propanoate |
| SMILES | C=CCN([C@H](CC(=O)OC(C)(C)C)c1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C24H31NO2/c1-6-17-25(19(2)20-13-9-7-10-14-20)22(21-15-11-8-12-16-21)18-23(26)27-24(3,4)5/h6-16,19,22H,1,17-18H2,2-5H3/t19-,22+/m0/s1 |
| InChIKey | QQDBXALSNZNIAF-SIKLNZKXSA-N |
| XLogP | 5.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|