C22H27NO — CID 54367902
(3S)-3-methyl-4-phenyl-4-[[(1R)-1-phenylethyl]-prop-2-enylamino]butan-2-one (PubChem CID 54367902) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is (3S)-3-methyl-4-phenyl-4-[[(1R)-1-phenylethyl]-prop-2-enylamino]butan-2-one.
| Compound Name | (3S)-3-methyl-4-phenyl-4-[[(1R)-1-phenylethyl]-prop-2-enylamino]butan-2-one |
|---|---|
| PubChem CID | 54367902 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (3S)-3-methyl-4-phenyl-4-[[(1R)-1-phenylethyl]-prop-2-enylamino]butan-2-one |
| SMILES | C=CCN(C(c1ccccc1)[C@H](C)C(C)=O)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H27NO/c1-5-16-23(18(3)20-12-8-6-9-13-20)22(17(2)19(4)24)21-14-10-7-11-15-21/h5-15,17-18,22H,1,16H2,2-4H3/t17-,18-,22?/m1/s1 |
| InChIKey | RZHNMBRMJIRLHF-XWATYHNTSA-N |
| XLogP | 5.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|