C17H23NO3 — CID 11403533
ethyl (2R,3R)-3-[bis(prop-2-enyl)amino]-2-hydroxy-3-phenylpropanoate (PubChem CID 11403533) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[bis(prop-2-enyl)amino]-2-hydroxy-3-phenylpropanoate.
| Compound Name | ethyl (2R,3R)-3-[bis(prop-2-enyl)amino]-2-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 11403533 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl (2R,3R)-3-[bis(prop-2-enyl)amino]-2-hydroxy-3-phenylpropanoate |
| SMILES | C=CCN(CC=C)[C@H](c1ccccc1)[C@@H](O)C(=O)OCC |
| InChI | InChI=1S/C17H23NO3/c1-4-12-18(13-5-2)15(14-10-8-7-9-11-14)16(19)17(20)21-6-3/h4-5,7-11,15-16,19H,1-2,6,12-13H2,3H3/t15-,16-/m1/s1 |
| InChIKey | AWVDQCGWFUHVBS-HZPDHXFCSA-N |
| XLogP | 2.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|