C18H24O5 — CID 132540270
diethyl 2-[(1S,3R)-3-hydroxy-1-phenylpent-4-enyl]propanedioate (PubChem CID 132540270) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is diethyl 2-[(1S,3R)-3-hydroxy-1-phenylpent-4-enyl]propanedioate.
| Compound Name | diethyl 2-[(1S,3R)-3-hydroxy-1-phenylpent-4-enyl]propanedioate |
|---|---|
| PubChem CID | 132540270 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | diethyl 2-[(1S,3R)-3-hydroxy-1-phenylpent-4-enyl]propanedioate |
| SMILES | C=C[C@H](O)C[C@H](c1ccccc1)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H24O5/c1-4-14(19)12-15(13-10-8-7-9-11-13)16(17(20)22-5-2)18(21)23-6-3/h4,7-11,14-16,19H,1,5-6,12H2,2-3H3/t14-,15+/m0/s1 |
| InChIKey | GOABDCHKZRDCEQ-LSDHHAIUSA-N |
| XLogP | 2.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|