C19H26O5 — CID 132540269
diethyl 2-[(E,1S)-5-hydroxy-3-methyl-1-phenylpent-3-enyl]propanedioate (PubChem CID 132540269) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is diethyl 2-[(E,1S)-5-hydroxy-3-methyl-1-phenylpent-3-enyl]propanedioate.
| Compound Name | diethyl 2-[(E,1S)-5-hydroxy-3-methyl-1-phenylpent-3-enyl]propanedioate |
|---|---|
| PubChem CID | 132540269 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | diethyl 2-[(E,1S)-5-hydroxy-3-methyl-1-phenylpent-3-enyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](C/C(C)=C/CO)c1ccccc1 |
| InChI | InChI=1S/C19H26O5/c1-4-23-18(21)17(19(22)24-5-2)16(13-14(3)11-12-20)15-9-7-6-8-10-15/h6-11,16-17,20H,4-5,12-13H2,1-3H3/b14-11+/t16-/m1/s1 |
| InChIKey | UATAPNSJEGSKKN-WSYSLRRZSA-N |
| XLogP | 2.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|