C46H52N2O10 — CID 11686458
diethyl 2-[(3E)-3-[(E)-[5-ethoxy-4-ethoxycarbonyl-3-(4-methoxyphenyl)-5-oxo-1-phenylpentylidene]hydrazinylidene]-1-(4-methoxyphenyl)-3-phenylpropyl]propanedioate (PubChem CID 11686458) has the molecular formula C46H52N2O10 and a molecular weight of 792.93 g/mol. Its IUPAC name is diethyl 2-[(3E)-3-[(E)-[5-ethoxy-4-ethoxycarbonyl-3-(4-methoxyphenyl)-5-oxo-1-phenylpentylidene]hydrazinylidene]-1-(4-methoxyphenyl)-3-phenylpropyl]propanedioate.
| Compound Name | diethyl 2-[(3E)-3-[(E)-[5-ethoxy-4-ethoxycarbonyl-3-(4-methoxyphenyl)-5-oxo-1-phenylpentylidene]hydrazinylidene]-1-(4-methoxyphenyl)-3-phenylpropyl]propanedioate |
|---|---|
| PubChem CID | 11686458 |
| Molecular Formula | C46H52N2O10 |
| Molecular Weight | 792.93 g/mol |
| Exact Mass | 792.36 |
| IUPAC Name | diethyl 2-[(3E)-3-[(E)-[5-ethoxy-4-ethoxycarbonyl-3-(4-methoxyphenyl)-5-oxo-1-phenylpentylidene]hydrazinylidene]-1-(4-methoxyphenyl)-3-phenylpropyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C/C(=N\N=C(/CC(c1ccc(OC)cc1)C(C(=O)OCC)C(=O)OCC)c1ccccc1)c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C46H52N2O10/c1-7-55-43(49)41(44(50)56-8-2)37(31-21-25-35(53-5)26-22-31)29-39(33-17-13-11-14-18-33)47-48-40(34-19-15-12-16-20-34)30-38(32-23-27-36(54-6)28-24-32)42(45(51)57-9-3)46(52)58-10-4/h11-28,37-38,41-42H,7-10,29-30H2,1-6H3/b47-39+,48-40+ |
| InChIKey | YYSUCXJODPFTHN-AOMVDHELSA-N |
| XLogP | 7.73 |
| TPSA | 148.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.93 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|