C23H31NO3 — CID 11089968
tert-butyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxybutanoate (PubChem CID 11089968) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxybutanoate.
| Compound Name | tert-butyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxybutanoate |
|---|---|
| PubChem CID | 11089968 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | tert-butyl (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-2-hydroxybutanoate |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@@H](C)[C@H](O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H31NO3/c1-17(20-14-10-7-11-15-20)24(16-19-12-8-6-9-13-19)18(2)21(25)22(26)27-23(3,4)5/h6-15,17-18,21,25H,16H2,1-5H3/t17-,18-,21-/m0/s1 |
| InChIKey | JRBPZDZFCLSTDV-WFXMLNOXSA-N |
| XLogP | 4.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |