C23H30N4O2 — CID 11784210
tert-butyl (2S,3S)-2-azido-3-[benzyl-[(1S)-1-phenylethyl]amino]butanoate (PubChem CID 11784210) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-azido-3-[benzyl-[(1S)-1-phenylethyl]amino]butanoate.
| Compound Name | tert-butyl (2S,3S)-2-azido-3-[benzyl-[(1S)-1-phenylethyl]amino]butanoate |
|---|---|
| PubChem CID | 11784210 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | tert-butyl (2S,3S)-2-azido-3-[benzyl-[(1S)-1-phenylethyl]amino]butanoate |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@@H](C)[C@H](N=[N+]=[N-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H30N4O2/c1-17(20-14-10-7-11-15-20)27(16-19-12-8-6-9-13-19)18(2)21(25-26-24)22(28)29-23(3,4)5/h6-15,17-18,21H,16H2,1-5H3/t17-,18-,21-/m0/s1 |
| InChIKey | URLJFZCIIJNYFI-WFXMLNOXSA-N |
| XLogP | 5.66 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|