C26H36ClNO3 — CID 102370548
ethyl (3S)-8-chloro-3-[(4-methoxyphenyl)methyl-[(1S)-1-phenylethyl]amino]octanoate (PubChem CID 102370548) has the molecular formula C26H36ClNO3 and a molecular weight of 446.03 g/mol. Its IUPAC name is ethyl (3S)-8-chloro-3-[(4-methoxyphenyl)methyl-[(1S)-1-phenylethyl]amino]octanoate.
| Compound Name | ethyl (3S)-8-chloro-3-[(4-methoxyphenyl)methyl-[(1S)-1-phenylethyl]amino]octanoate |
|---|---|
| PubChem CID | 102370548 |
| Molecular Formula | C26H36ClNO3 |
| Molecular Weight | 446.03 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | ethyl (3S)-8-chloro-3-[(4-methoxyphenyl)methyl-[(1S)-1-phenylethyl]amino]octanoate |
| SMILES | CCOC(=O)C[C@H](CCCCCCl)N(Cc1ccc(OC)cc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H36ClNO3/c1-4-31-26(29)19-24(13-9-6-10-18-27)28(21(2)23-11-7-5-8-12-23)20-22-14-16-25(30-3)17-15-22/h5,7-8,11-12,14-17,21,24H,4,6,9-10,13,18-20H2,1-3H3/t21-,24-/m0/s1 |
| InChIKey | VYBCTKLALVLCBQ-URXFXBBRSA-N |
| XLogP | 6.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.03 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|