C28H33NO4 — CID 11213030
ethyl (3R,4R)-4-(dibenzylamino)-3-hydroxy-5-(4-methoxyphenyl)pentanoate (PubChem CID 11213030) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is ethyl (3R,4R)-4-(dibenzylamino)-3-hydroxy-5-(4-methoxyphenyl)pentanoate.
| Compound Name | ethyl (3R,4R)-4-(dibenzylamino)-3-hydroxy-5-(4-methoxyphenyl)pentanoate |
|---|---|
| PubChem CID | 11213030 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | ethyl (3R,4R)-4-(dibenzylamino)-3-hydroxy-5-(4-methoxyphenyl)pentanoate |
| SMILES | CCOC(=O)C[C@@H](O)[C@@H](Cc1ccc(OC)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H33NO4/c1-3-33-28(31)19-27(30)26(18-22-14-16-25(32-2)17-15-22)29(20-23-10-6-4-7-11-23)21-24-12-8-5-9-13-24/h4-17,26-27,30H,3,18-21H2,1-2H3/t26-,27-/m1/s1 |
| InChIKey | QVZRTCJEBAFNEX-KAYWLYCHSA-N |
| XLogP | 4.62 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |