C27H31NO5 — CID 102383382
ethyl 2-(dibenzylamino)-2-(2,4,6-trimethoxyphenyl)acetate (PubChem CID 102383382) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is ethyl 2-(dibenzylamino)-2-(2,4,6-trimethoxyphenyl)acetate.
| Compound Name | ethyl 2-(dibenzylamino)-2-(2,4,6-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 102383382 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | ethyl 2-(dibenzylamino)-2-(2,4,6-trimethoxyphenyl)acetate |
| SMILES | CCOC(=O)C(c1c(OC)cc(OC)cc1OC)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H31NO5/c1-5-33-27(29)26(25-23(31-3)16-22(30-2)17-24(25)32-4)28(18-20-12-8-6-9-13-20)19-21-14-10-7-11-15-21/h6-17,26H,5,18-19H2,1-4H3 |
| InChIKey | BINIPUSDRZFINQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |