C33H36N2O2 — CID 146168369
ethyl (2S)-2,3-bis(dibenzylamino)propanoate (PubChem CID 146168369) has the molecular formula C33H36N2O2 and a molecular weight of 492.66 g/mol. Its IUPAC name is ethyl (2S)-2,3-bis(dibenzylamino)propanoate.
| Compound Name | ethyl (2S)-2,3-bis(dibenzylamino)propanoate |
|---|---|
| PubChem CID | 146168369 |
| Molecular Formula | C33H36N2O2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | ethyl (2S)-2,3-bis(dibenzylamino)propanoate |
| SMILES | CCOC(=O)[C@H](CN(Cc1ccccc1)Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C33H36N2O2/c1-2-37-33(36)32(35(25-30-19-11-5-12-20-30)26-31-21-13-6-14-22-31)27-34(23-28-15-7-3-8-16-28)24-29-17-9-4-10-18-29/h3-22,32H,2,23-27H2,1H3/t32-/m0/s1 |
| InChIKey | QDXLVNZLBWXNSP-YTTGMZPUSA-N |
| XLogP | 6.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |