C24H31NO4 — CID 102464629
diethyl 3-(dibenzylamino)-2,2-dimethylbutanedioate (PubChem CID 102464629) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is diethyl 3-(dibenzylamino)-2,2-dimethylbutanedioate.
| Compound Name | diethyl 3-(dibenzylamino)-2,2-dimethylbutanedioate |
|---|---|
| PubChem CID | 102464629 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | diethyl 3-(dibenzylamino)-2,2-dimethylbutanedioate |
| SMILES | CCOC(=O)C(N(Cc1ccccc1)Cc1ccccc1)C(C)(C)C(=O)OCC |
| InChI | InChI=1S/C24H31NO4/c1-5-28-22(26)21(24(3,4)23(27)29-6-2)25(17-19-13-9-7-10-14-19)18-20-15-11-8-12-16-20/h7-16,21H,5-6,17-18H2,1-4H3 |
| InChIKey | LVYGTRSIJQETBN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |