C17H26O3S — CID 10852469
ethyl 4-benzylsulfanyl-3-hydroxy-2,2,4-trimethylpentanoate (PubChem CID 10852469) has the molecular formula C17H26O3S and a molecular weight of 310.46 g/mol. Its IUPAC name is ethyl 4-benzylsulfanyl-3-hydroxy-2,2,4-trimethylpentanoate.
| Compound Name | ethyl 4-benzylsulfanyl-3-hydroxy-2,2,4-trimethylpentanoate |
|---|---|
| PubChem CID | 10852469 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | ethyl 4-benzylsulfanyl-3-hydroxy-2,2,4-trimethylpentanoate |
| SMILES | CCOC(=O)C(C)(C)C(O)C(C)(C)SCc1ccccc1 |
| InChI | InChI=1S/C17H26O3S/c1-6-20-15(19)16(2,3)14(18)17(4,5)21-12-13-10-8-7-9-11-13/h7-11,14,18H,6,12H2,1-5H3 |
| InChIKey | SWIBMTSLEKHTNI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |