C14H19ClO5S — CID 135339077
ethyl 3-chlorosulfonyloxy-2,2-dimethyl-4-phenylbutanoate (PubChem CID 135339077) has the molecular formula C14H19ClO5S and a molecular weight of 334.82 g/mol. Its IUPAC name is ethyl 3-chlorosulfonyloxy-2,2-dimethyl-4-phenylbutanoate.
| Compound Name | ethyl 3-chlorosulfonyloxy-2,2-dimethyl-4-phenylbutanoate |
|---|---|
| PubChem CID | 135339077 |
| Molecular Formula | C14H19ClO5S |
| Molecular Weight | 334.82 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | ethyl 3-chlorosulfonyloxy-2,2-dimethyl-4-phenylbutanoate |
| SMILES | CCOC(=O)C(C)(C)C(Cc1ccccc1)OS(=O)(=O)Cl |
| InChI | InChI=1S/C14H19ClO5S/c1-4-19-13(16)14(2,3)12(20-21(15,17)18)10-11-8-6-5-7-9-11/h5-9,12H,4,10H2,1-3H3 |
| InChIKey | YRJUOJOSTKSDBK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |