C29H49NO4 — CID 91458273
ethyl 5-[benzyl-(5-ethoxy-2,2,4,4-tetramethyl-5-oxopentyl)amino]-2,2,4,4-tetramethylpentanoate (PubChem CID 91458273) has the molecular formula C29H49NO4 and a molecular weight of 475.71 g/mol. Its IUPAC name is ethyl 5-[benzyl-(5-ethoxy-2,2,4,4-tetramethyl-5-oxopentyl)amino]-2,2,4,4-tetramethylpentanoate.
| Compound Name | ethyl 5-[benzyl-(5-ethoxy-2,2,4,4-tetramethyl-5-oxopentyl)amino]-2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 91458273 |
| Molecular Formula | C29H49NO4 |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.37 |
| IUPAC Name | ethyl 5-[benzyl-(5-ethoxy-2,2,4,4-tetramethyl-5-oxopentyl)amino]-2,2,4,4-tetramethylpentanoate |
| SMILES | CCOC(=O)C(C)(C)CC(C)(C)CN(Cc1ccccc1)CC(C)(C)CC(C)(C)C(=O)OCC |
| InChI | InChI=1S/C29H49NO4/c1-11-33-24(31)28(7,8)19-26(3,4)21-30(18-23-16-14-13-15-17-23)22-27(5,6)20-29(9,10)25(32)34-12-2/h13-17H,11-12,18-22H2,1-10H3 |
| InChIKey | GYNIMFALYDHBSK-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |