C15H22BrNO2S — CID 137487764
ethyl 3-[[3-(bromomethyl)phenyl]sulfanyl-methylamino]-2,2-dimethylpropanoate (PubChem CID 137487764) has the molecular formula C15H22BrNO2S and a molecular weight of 360.32 g/mol. Its IUPAC name is ethyl 3-[[3-(bromomethyl)phenyl]sulfanyl-methylamino]-2,2-dimethylpropanoate.
| Compound Name | ethyl 3-[[3-(bromomethyl)phenyl]sulfanyl-methylamino]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 137487764 |
| Molecular Formula | C15H22BrNO2S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | ethyl 3-[[3-(bromomethyl)phenyl]sulfanyl-methylamino]-2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(C)(C)CN(C)Sc1cccc(CBr)c1 |
| InChI | InChI=1S/C15H22BrNO2S/c1-5-19-14(18)15(2,3)11-17(4)20-13-8-6-7-12(9-13)10-16/h6-9H,5,10-11H2,1-4H3 |
| InChIKey | RDGRBHWEWJMHJQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|