C15H21BrO2 — CID 19957550
ethyl 3-[4-(2-bromoethyl)phenyl]-2,2-dimethylpropanoate (PubChem CID 19957550) has the molecular formula C15H21BrO2 and a molecular weight of 313.24 g/mol. Its IUPAC name is ethyl 3-[4-(2-bromoethyl)phenyl]-2,2-dimethylpropanoate.
| Compound Name | ethyl 3-[4-(2-bromoethyl)phenyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 19957550 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | ethyl 3-[4-(2-bromoethyl)phenyl]-2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Cc1ccc(CCBr)cc1 |
| InChI | InChI=1S/C15H21BrO2/c1-4-18-14(17)15(2,3)11-13-7-5-12(6-8-13)9-10-16/h5-8H,4,9-11H2,1-3H3 |
| InChIKey | CUORAJDEDGWFKM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|