C13H18O2S — CID 4114055
ethyl 2,2-dimethyl-3-(4-sulfanylphenyl)propanoate (PubChem CID 4114055) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-3-(4-sulfanylphenyl)propanoate.
| Compound Name | ethyl 2,2-dimethyl-3-(4-sulfanylphenyl)propanoate |
|---|---|
| PubChem CID | 4114055 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | ethyl 2,2-dimethyl-3-(4-sulfanylphenyl)propanoate |
| SMILES | CCOC(=O)C(C)(C)Cc1ccc(S)cc1 |
| InChI | InChI=1S/C13H18O2S/c1-4-15-12(14)13(2,3)9-10-5-7-11(16)8-6-10/h5-8,16H,4,9H2,1-3H3 |
| InChIKey | GARCOZSVVMBQFJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|