C17H23NO5S — CID 10807990
diethyl 2-acetamido-2-[2-(4-sulfanylphenyl)ethyl]propanedioate (PubChem CID 10807990) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[2-(4-sulfanylphenyl)ethyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[2-(4-sulfanylphenyl)ethyl]propanedioate |
|---|---|
| PubChem CID | 10807990 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | diethyl 2-acetamido-2-[2-(4-sulfanylphenyl)ethyl]propanedioate |
| SMILES | CCOC(=O)C(CCc1ccc(S)cc1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C17H23NO5S/c1-4-22-15(20)17(18-12(3)19,16(21)23-5-2)11-10-13-6-8-14(24)9-7-13/h6-9,24H,4-5,10-11H2,1-3H3,(H,18,19) |
| InChIKey | DBLAFDQJPVXABP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|