C27H45NO6Si — CID 139768327
diethyl 2-acetamido-2-[2-[4-(7-trimethylsilylheptoxy)phenyl]ethyl]propanedioate (PubChem CID 139768327) has the molecular formula C27H45NO6Si and a molecular weight of 507.74 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[2-[4-(7-trimethylsilylheptoxy)phenyl]ethyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[2-[4-(7-trimethylsilylheptoxy)phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 139768327 |
| Molecular Formula | C27H45NO6Si |
| Molecular Weight | 507.74 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | diethyl 2-acetamido-2-[2-[4-(7-trimethylsilylheptoxy)phenyl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(CCc1ccc(OCCCCCCC[Si](C)(C)C)cc1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C27H45NO6Si/c1-7-32-25(30)27(28-22(3)29,26(31)33-8-2)19-18-23-14-16-24(17-15-23)34-20-12-10-9-11-13-21-35(4,5)6/h14-17H,7-13,18-21H2,1-6H3,(H,28,29) |
| InChIKey | FINXXAMWBZAEQA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.74 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|