C25H41NO5 — CID 139719762
ethyl 2-[2-(4-heptoxyphenyl)ethyl]-2-[(methoxycarbonylamino)methyl]pentanoate (PubChem CID 139719762) has the molecular formula C25H41NO5 and a molecular weight of 435.61 g/mol. Its IUPAC name is ethyl 2-[2-(4-heptoxyphenyl)ethyl]-2-[(methoxycarbonylamino)methyl]pentanoate.
| Compound Name | ethyl 2-[2-(4-heptoxyphenyl)ethyl]-2-[(methoxycarbonylamino)methyl]pentanoate |
|---|---|
| PubChem CID | 139719762 |
| Molecular Formula | C25H41NO5 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | ethyl 2-[2-(4-heptoxyphenyl)ethyl]-2-[(methoxycarbonylamino)methyl]pentanoate |
| SMILES | CCCCCCCOc1ccc(CCC(CCC)(CNC(=O)OC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C25H41NO5/c1-5-8-9-10-11-19-31-22-14-12-21(13-15-22)16-18-25(17-6-2,23(27)30-7-3)20-26-24(28)29-4/h12-15H,5-11,16-20H2,1-4H3,(H,26,28) |
| InChIKey | FWGGAXWBASZDIJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|