C50H80O10 — CID 70146121
diethyl 2-butyl-2-[2-(4-heptoxyphenyl)ethyl]propanedioate;2-ethoxycarbonyl-2-[2-(4-heptoxyphenyl)ethyl]hexanoic acid (PubChem CID 70146121) has the molecular formula C50H80O10 and a molecular weight of 841.18 g/mol. Its IUPAC name is diethyl 2-butyl-2-[2-(4-heptoxyphenyl)ethyl]propanedioate;2-ethoxycarbonyl-2-[2-(4-heptoxyphenyl)ethyl]hexanoic acid.
| Compound Name | diethyl 2-butyl-2-[2-(4-heptoxyphenyl)ethyl]propanedioate;2-ethoxycarbonyl-2-[2-(4-heptoxyphenyl)ethyl]hexanoic acid |
|---|---|
| PubChem CID | 70146121 |
| Molecular Formula | C50H80O10 |
| Molecular Weight | 841.18 g/mol |
| Exact Mass | 840.58 |
| IUPAC Name | diethyl 2-butyl-2-[2-(4-heptoxyphenyl)ethyl]propanedioate;2-ethoxycarbonyl-2-[2-(4-heptoxyphenyl)ethyl]hexanoic acid |
| SMILES | CCCCCCCOc1ccc(CCC(CCCC)(C(=O)O)C(=O)OCC)cc1.CCCCCCCOc1ccc(CCC(CCCC)(C(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C26H42O5.C24H38O5/c1-5-9-11-12-13-21-31-23-16-14-22(15-17-23)18-20-26(19-10-6-2,24(27)29-7-3)25(28)30-8-4;1-4-7-9-10-11-19-29-21-14-12-20(13-15-21)16-18-24(22(25)26,17-8-5-2)23(27)28-6-3/h14-17H,5-13,18-21H2,1-4H3;12-15H,4-11,16-19H2,1-3H3,(H,25,26) |
| InChIKey | RPFFPWKCNSWQAS-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.18 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|